CymitQuimica logo

CAS 881913-20-8

:

3-(1-Naphthyl)phenylboronic acid

Description:
3-(1-Naphthyl)phenylboronic acid is an organoboron compound characterized by the presence of both a boronic acid functional group and aromatic rings. It features a boron atom bonded to a hydroxyl group and two aromatic moieties: a phenyl group and a naphthyl group. This compound is typically used in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions, which are essential for forming carbon-carbon bonds. The presence of the boronic acid group allows for the formation of stable complexes with diols and sugars, making it useful in biochemical applications as well. Its solubility is generally influenced by the nature of the substituents on the aromatic rings, and it may exhibit moderate solubility in polar organic solvents. Additionally, 3-(1-Naphthyl)phenylboronic acid can participate in various chemical reactions, including nucleophilic substitutions and coordination chemistry, making it a versatile building block in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C16H13BO2
InChI:InChI=1S/C16H13BO2/c18-17(19)14-8-3-7-13(11-14)16-10-4-6-12-5-1-2-9-15(12)16/h1-11,18-19H
InChI key:HFXYUCJLQZCNPD-UHFFFAOYSA-N
SMILES:B(C1=CC(=CC=C1)C2=CC=CC3=CC=CC=C32)(O)O
Synonyms:
  • 3-(Naphthalen-1-yl)phenylboronic acid
  • Boronic acid, [3-(1-naphthalenyl)phenyl]-
Found 5 products.