CAS 88192-22-7
:(2R,5R)-hept-6-yne-2,5-diamine
Description:
(2R,5R)-hept-6-yne-2,5-diamine is an organic compound characterized by its alkyne functional group and two amine groups. It features a seven-carbon chain with a triple bond located between the sixth and seventh carbon atoms, which contributes to its reactivity and potential applications in organic synthesis. The presence of two amine groups at the 2 and 5 positions enhances its ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The specific stereochemistry indicated by the (2R,5R) configuration suggests that the compound has defined spatial arrangements, which can influence its biological activity and interaction with other molecules. This compound may be of interest in medicinal chemistry and materials science due to its potential as a building block for more complex structures. Additionally, its properties, such as solubility and boiling point, are influenced by the presence of the alkyne and amine groups, making it a versatile compound in synthetic organic chemistry.
Formula:C7H14N2
InChI:InChI=1/C7H14N2/c1-3-7(9)5-4-6(2)8/h1,6-7H,4-5,8-9H2,2H3/t6-,7+/m1/s1
Synonyms:- 6-Heptyne-2,5-diamine, (2R,5R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
