CAS 88192-97-6

Octanoic acid, 2,5-dimethyl-, methyl ester

Description:

Octanoic acid, 2,5-dimethyl-, methyl ester, with the CAS number 88192-97-6, is an ester derived from octanoic acid and 2,5-dimethyl-1-hexanol. This compound typically exhibits a characteristic fatty acid odor and is a colorless to pale yellow liquid at room temperature. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The presence of the methyl ester functional group contributes to its reactivity, making it susceptible to hydrolysis in the presence of water and acids or bases. Octanoic acid derivatives are often used in the production of surfactants, flavoring agents, and as intermediates in organic synthesis. Additionally, this compound may exhibit low toxicity, but safety precautions should be taken when handling it, as with all chemical substances. Its applications can extend to the food and cosmetic industries, where it may serve as an emulsifier or fragrance component.

Formula: C₁₁H₂₂O₂

InChI: InChI=1S/C11H22O2/c1-5-6-9(2)7-8-10(3)11(12)13-4/h9-10H,5-8H2,1-4H3

InChI key: VVQFYBLJVQYZSB-UHFFFAOYSA-N

SMILES: CCCC(C)CCC(C)C(=O)OC