CAS 88195-31-7

2-[hydroxy(nitroso)amino]propan-1-ol

Description:

2-[Hydroxy(nitroso)amino]propan-1-ol, with the CAS number 88195-31-7, is a chemical compound characterized by its unique functional groups, including a hydroxyl group and a nitroso group attached to an amino group. This compound is typically classified as an organic nitrogen compound and may exhibit properties such as being a potential intermediate in various chemical reactions. Its structure suggests it may participate in hydrogen bonding due to the presence of the hydroxyl group, which can influence its solubility in polar solvents. The nitroso group may impart specific reactivity, making it of interest in synthetic organic chemistry and potentially in medicinal chemistry for its biological activity. The compound's stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including pH, temperature, and the presence of other reagents. As with many nitrogen-containing compounds, safety precautions should be observed due to the potential for toxicity or reactivity.

Formula: C₃H₈N₂O₃

InChI: InChI=1/C3H8N2O3/c1-3(2-6)5(8)4-7/h3,6,8H,2H2,1H3

Synonyms:

• 1-Propanol, 2-(hydroxynitrosoamino)-, (+)-

1-Propanol, 2-(hydroxynitrosoamino)-

CAS: 88195-31-7

Formula: C₃H₈N₂O₃

Molecular weight: 120.1072

Ref: IN-DA004C80