CAS 881986-39-6

5-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)pentanoic acid

Description:

5-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)pentanoic acid, with the CAS number 881986-39-6, is a chemical compound characterized by its unique structure that includes an isoindole moiety and a pentanoic acid chain. This compound features a carbonyl group adjacent to the isoindole structure, contributing to its reactivity and potential biological activity. The presence of the pentanoic acid side chain suggests that it may exhibit properties typical of carboxylic acids, such as acidity and the ability to form esters or amides. The isoindole framework is known for its occurrence in various natural products and pharmaceuticals, indicating potential applications in medicinal chemistry. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a candidate for further research in drug development or synthetic chemistry. Overall, this compound's structural characteristics suggest it may have interesting chemical and biological properties worthy of exploration.

Formula: C₁₃H₁₅NO₃

InChI: InChI=1/C13H15NO3/c15-12(16)7-3-4-8-14-9-10-5-1-2-6-11(10)13(14)17/h1-2,5-6H,3-4,7-9H2,(H,15,16)

SMILES: c1ccc2c(c1)CN(CCCCC(=O)O)C2=O

Synonyms:

• 2H-isoindole-2-pentanoic acid, 1,3-dihydro-1-oxo-