CymitQuimica logo

CAS 88199-84-2

:

methyl (10E)-9-oxo-11-[(2R,3S)-3-pentyloxiran-2-yl]undec-10-enoate

Description:
Methyl (10E)-9-oxo-11-[(2R,3S)-3-pentyloxiran-2-yl]undec-10-enoate is a complex organic compound characterized by its unique structural features, including a long carbon chain and an epoxide group. This substance belongs to the class of esters, specifically an unsaturated ester, which is indicated by the presence of a double bond in its carbon chain. The compound exhibits a ketone functional group, as denoted by the "9-oxo" part of its name, contributing to its reactivity and potential applications in organic synthesis. The stereochemistry of the epoxide ring is specified by the (2R,3S) configuration, which can influence the compound's biological activity and interaction with other molecules. Its molecular structure suggests potential uses in fields such as pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The presence of multiple functional groups allows for diverse reactivity, making it a candidate for further chemical transformations. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C19H32O4
InChI:InChI=1/C19H32O4/c1-3-4-8-12-17-18(23-17)15-14-16(20)11-9-6-5-7-10-13-19(21)22-2/h14-15,17-18H,3-13H2,1-2H3/b15-14+/t17-,18+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.