CAS 881995-46-6
:3-(2-methylphenoxy)-3-phenyl-propan-1-amine hydrochloride
Description:
3-(2-methylphenoxy)-3-phenyl-propan-1-amine hydrochloride, with the CAS number 881995-46-6, is a chemical compound that belongs to the class of amines. It features a propanamine backbone substituted with a 2-methylphenoxy group and a phenyl group, which contributes to its unique properties. This compound is typically characterized by its hydrochloride salt form, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of aromatic rings in its structure suggests potential interactions with biological targets, which may influence its pharmacological activity. As with many amines, it may exhibit basic properties, allowing it to form salts with acids. The compound's specific characteristics, such as melting point, boiling point, and spectral data, would depend on its purity and the conditions under which it is studied. Safety data sheets should be consulted for handling and toxicity information, as with any chemical substance.
Formula:C16H20ClNO
InChI:InChI=1/C16H19NO.ClH/c1-13-7-5-6-10-15(13)18-16(11-12-17)14-8-3-2-4-9-14;/h2-10,16H,11-12,17H2,1H3;1H
SMILES:Cc1ccccc1OC(CCN)c1ccccc1.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
rac-N-Desmethyl Atomoxetine HCl
CAS:Formula:C16H19NO·HClColor and Shape:White To Off-White SolidMolecular weight:241.33 36.46(R)-Desmethyl Atomoxetine Hydrochloride
CAS:Controlled ProductFormula:C16H19NO·HClColor and Shape:Off-WhiteMolecular weight:277.79Desmethyl atomoxetine hydrochloride
CAS:<p>Desmethyl atomoxetine hydrochloride is a chemical compound that can be used as a reaction component, a reagent, or a useful scaffold. It is an intermediate for the production of other chemicals and has many uses in industry. Desmethyl atomoxetine hydrochloride is also one of the building blocks used to produce speciality chemicals and fine chemicals. This chemical compound has been assigned CAS number 881995-46-6.</p>Formula:C16H19NO•HClPurity:Min. 95%Color and Shape:White To Light (Or Pale) Yellow SolidMolecular weight:277.79 g/mol




