CAS 882-06-4
:trans-4-Nitrocinnamic acid
Description:
Trans-4-Nitrocinnamic acid is an organic compound characterized by its aromatic structure and functional groups. It features a trans configuration, indicating that the nitro group and the carboxylic acid group are positioned on opposite sides of the double bond in the cinnamic acid backbone. This compound is typically a yellow crystalline solid, exhibiting a melting point that varies depending on purity and conditions. It is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. The presence of the nitro group contributes to its electron-withdrawing properties, influencing its reactivity and potential applications in organic synthesis and materials science. Trans-4-Nitrocinnamic acid can participate in various chemical reactions, including esterification and reduction, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, it has been studied for its potential use in photochemical applications due to its ability to undergo isomerization upon exposure to light. Overall, trans-4-Nitrocinnamic acid is a significant compound in both academic research and industrial applications.
Formula:C9H7NO4
InChI:InChI=1S/C9H7NO4/c11-9(12)6-3-7-1-4-8(5-2-7)10(13)14/h1-6H,(H,11,12)/b6-3+
InChI key:InChIKey=XMMRNCHTDONGRJ-ZZXKWVIFSA-N
SMILES:N(=O)(=O)C1=CC=C(/C=C/C(O)=O)C=C1
Synonyms:- (2E)-3-(4-Nitrophenyl)-2-propenoic acid
- (E)-3-(4-Nitrophenyl)acrylic acid
- (E)-4-Nitrocinnamic acid
- (E)-p-Nitrocinnamic acid
- 2-Propenoic acid, 3-(4-nitrophenyl)-, (2E)-
- 2-Propenoic acid, 3-(4-nitrophenyl)-, (E)-
- Cinnamic acid, p-nitro-, (E)-
- trans-p-Nitrocinnamic acid
- trans-4-Nitrocinnamic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
trans-4-Nitrocinnamic acid, 98+%
CAS:trans-4-Nitrocinnamic acid, is used as a raw material for saccharine. It is also used as a useful chemical for biological applications. Some other applications include it is used as an organic intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar productFormula:C9H7NO4Purity:98+%Color and Shape:White to cream to yellow, Powder or crystalline powderMolecular weight:193.16(E)-3-(4-Nitrophenyl)acrylic acid
CAS:Formula:C9H7NO4Purity:98%Color and Shape:SolidMolecular weight:193.1562trans-4-Nitrocinnamic acid
CAS:Trans-4-nitrocinnamic acid is an organic compound that is synthesized from 4-hydroxycinnamic acid by nitration with aqueous or alcoholic nitric acid. Trans-4-Nitrocinnamic acid has been shown to inhibit tyrosinase activity in the presence of metal hydroxides, such as copper, zinc, and iron. The reaction mechanism is unclear but may involve an initial protonation of the phenolic group followed by an electron transfer to the nitro group. This reaction results in an irreversible inhibition of tyrosinase activity. Trans-4-Nitrocinnamic acid also reacts with hydrochloric acid to produce a carboxylate salt that can be used for sample preparation.
Formula:C9H7NO4Purity:Min. 95%Color and Shape:PowderMolecular weight:193.16 g/molRef: 3D-FN30623
Discontinued product


