CAS 882-07-5
:N-(5,5-Dimethyl-3-oxo-1-cyclohexen-1-yl)glycine
Description:
N-(5,5-Dimethyl-3-oxo-1-cyclohexen-1-yl)glycine, with the CAS number 882-07-5, is an organic compound that features a cyclohexene ring substituted with a glycine moiety. This compound is characterized by its unique structure, which includes a ketone functional group and a glycine amino acid derivative. The presence of the cyclohexene ring contributes to its potential reactivity and stability under various conditions. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical and agricultural applications. The dimethyl substitution on the cyclohexene ring can influence the compound's steric properties and solubility, affecting its interactions with biological targets. Additionally, the presence of both the carbonyl and amino groups suggests potential for hydrogen bonding and other intermolecular interactions, which can be crucial for its behavior in solution and in biological systems. Overall, N-(5,5-Dimethyl-3-oxo-1-cyclohexen-1-yl)glycine represents a structurally interesting compound with potential applications in various fields of chemistry and biochemistry.
Formula:C10H15NO3
InChI:InChI=1S/C10H15NO3/c1-10(2)4-7(3-8(12)5-10)11-6-9(13)14/h3,11H,4-6H2,1-2H3,(H,13,14)
InChI key:InChIKey=MKILHWOJDFVJNQ-UHFFFAOYSA-N
SMILES:N(CC(O)=O)C=1CC(C)(C)CC(=O)C1
Synonyms:- Glycine, N-(5,5-dimethyl-3-oxo-1-cyclohexen-1-yl)-
- 2-[(5,5-Dimethyl-3-oxocyclohex-1-en-1-yl)amino]acetic acid
- (5,5-Dimethyl-3-oxo-cyclohex-1-enylamino)-acetic acid
- 2-[(5,5-Dimethyl-3-oxocyclohexen-1-yl)amino]acetic acid
- N-(5,5-Dimethyl-3-oxo-1-cyclohexen-1-yl)glycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
