CAS 882-34-8

1,1′-(1,2-Ethenediyl)bis[piperidine]

Description:

1,1′-(1,2-Ethenediyl)bis[piperidine], also known by its CAS number 882-34-8, is an organic compound characterized by its unique structure, which features two piperidine rings connected by a vinylene (ethenediyl) bridge. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It exhibits basic properties due to the presence of the piperidine moieties, which can participate in various chemical reactions, including nucleophilic substitutions and polymerization processes. The compound is soluble in organic solvents, making it useful in various chemical applications, including as a building block in organic synthesis and potentially in the development of polymers or other materials. Its reactivity and structural features make it of interest in medicinal chemistry and materials science. However, safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.

Formula: C₁₂H₂₂N₂

InChI: InChI=1S/C12H22N2/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h11-12H,1-10H2

InChI key: InChIKey=KWLMEYGINFZGPL-UHFFFAOYSA-N

SMILES: C(=CN1CCCCC1)N2CCCCC2

Synonyms:

• 1,2-Dipiperidinoethene
• 1,1′-Vinylenedipiperidine
• Piperidine, 1,1′-(1,2-ethenediyl)bis-
• 1,1′-(1,2-Ethenediyl)bis[piperidine]
• Piperidine, 1,1′-vinylenedi-

Piperidine, 1,1'-(1,2-ethenediyl)bis-

CAS: 882-34-8

Formula: C₁₂H₂₂N₂

Molecular weight: 194.3165

Ref: IN-DA004CXA