CymitQuimica logo

CAS 882-58-6

:

Phosphazine

Description:
Phosphazine, with the CAS number 882-58-6, is a chemical compound characterized by its unique structure, which features alternating phosphorus and nitrogen atoms in a cyclic arrangement. This compound is part of a broader class known as phosphazenes, which are notable for their versatile properties and applications. Phosphazine typically exhibits a high degree of thermal stability and can be synthesized through various methods, including the reaction of phosphorus trichloride with ammonia. Its molecular structure often allows for the incorporation of various substituents, which can modify its chemical and physical properties, making it useful in diverse applications such as flame retardants, elastomers, and as precursors in the synthesis of other materials. Additionally, phosphazine compounds can display interesting coordination chemistry, interacting with metals to form complexes. Due to its nitrogen content, phosphazine can also exhibit some degree of reactivity, particularly in the presence of strong nucleophiles or electrophiles. Overall, phosphazine is a significant compound in both industrial and research contexts due to its unique characteristics and functional versatility.
Formula:C8H12N5OP
InChI:InChI=1S/C8H12N5OP/c14-15(12-4-5-12,13-6-7-13)11-8-9-2-1-3-10-8/h1-3H,4-7H2,(H,9,10,11,14)
InChI key:InChIKey=IFVGFQAONSKBCR-UHFFFAOYSA-N
SMILES:P(NC=1N=CC=CN1)(=O)(N2CC2)N3CC3
Synonyms:
  • Phosphemide
  • N-(Diethylenephosphoramido)-2-aminopyrimidine
  • Phosphazine
  • Phosphinic amide, P,P-bis(1-aziridinyl)-N-2-pyrimidinyl-
  • P,P-Bis(1-aziridinyl)-N-2-pyrimidinylphosphinic amide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.