CAS 882014-54-2

6-(4-Fluoro-2-methylphenyl)-2-pyridinamine

Description:

6-(4-Fluoro-2-methylphenyl)-2-pyridinamine, with the CAS number 882014-54-2, is an organic compound characterized by its pyridine and aniline functional groups. This substance features a pyridinamine core, which is a six-membered aromatic ring containing nitrogen, and is substituted with a 4-fluoro-2-methylphenyl group. The presence of the fluorine atom enhances its electronic properties, potentially influencing its reactivity and interactions in biological systems. The methyl group on the phenyl ring contributes to the compound's hydrophobic characteristics, which may affect its solubility and permeability in various environments. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Additionally, its unique combination of functional groups may impart specific biological activities, making it a candidate for further research in drug discovery and development. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally for practical applications.

Formula: C₁₂H₁₁FN₂

InChI: InChI=1S/C12H11FN2/c1-8-7-9(13)5-6-10(8)11-3-2-4-12(14)15-11/h2-7H,1H3,(H2,14,15)

InChI key: InChIKey=RFWLUBUKHBNIOC-UHFFFAOYSA-N

SMILES: CC1=C(C=2N=C(N)C=CC2)C=CC(F)=C1

Synonyms:

• 6-(4-Fluoro-2-methylphenyl)-2-pyridinamine
• 2-Pyridinamine, 6-(4-fluoro-2-methylphenyl)-