CymitQuimica logo

CAS 882016-49-1

:

N-[5-(hydroxymethyl)-2-pyridyl]-2,2-dimethyl-propanamide

Description:
N-[5-(hydroxymethyl)-2-pyridyl]-2,2-dimethyl-propanamide is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a hydroxymethyl group and an amide functional group. This compound typically exhibits properties associated with both amides and pyridine derivatives, such as moderate polarity and potential for hydrogen bonding due to the presence of the hydroxymethyl group. The dimethyl substitution on the propanamide backbone contributes to its steric bulk, which may influence its reactivity and interactions with biological targets. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where pyridine derivatives are often explored for their biological activity. Additionally, the presence of the hydroxymethyl group may enhance solubility in polar solvents, making it suitable for various chemical reactions and formulations. Overall, this compound represents a versatile structure with potential implications in both synthetic and medicinal chemistry.
Formula:C11H16N2O2
InChI:InChI=1/C11H16N2O2/c1-11(2,3)10(15)13-9-5-4-8(7-14)6-12-9/h4-6,14H,7H2,1-3H3,(H,12,13,15)
SMILES:CC(C)(C)C(=Nc1ccc(cn1)CO)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.