CAS 882029-13-2
:Ethyl 3-(2-trimethylacetamido-3-pyridyl)acrylate
Description:
Ethyl 3-(2-trimethylacetamido-3-pyridyl)acrylate, identified by its CAS number 882029-13-2, is an organic compound characterized by its unique structure that includes an ethyl ester group and a pyridine derivative. This compound typically exhibits properties associated with both esters and amides, such as moderate solubility in organic solvents and potential reactivity in various chemical reactions, including polymerization and condensation. The presence of the pyridine ring may impart specific biological activities or interactions, making it of interest in pharmaceutical and agrochemical applications. Additionally, the trimethylacetamido group suggests potential for hydrogen bonding and steric effects, influencing its reactivity and interactions with other molecules. Overall, this compound's characteristics make it a subject of interest in synthetic organic chemistry and material science, particularly in the development of novel compounds with specific functional properties.
Formula:C14H20N2O3
InChI:InChI=1/C12H14N2O3.C2H6/c1-3-17-11(16)7-6-10-5-4-8-13-12(10)14-9(2)15;1-2/h4-8H,3H2,1-2H3,(H,13,14,15);1-2H3
SMILES:CCOC(=O)C=Cc1cccnc1N=C(C)O.CC
Synonyms:- Ethane
- Ethyl 3-(2-Acetamido-3-Pyridyl)Prop-2-Enoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
