CAS 882029-22-3

2,2-Dimethyl-1-(6-methyl-3-pyridinyl)-1-propanone

Description:

2,2-Dimethyl-1-(6-methyl-3-pyridinyl)-1-propanone, with the CAS number 882029-22-3, is an organic compound characterized by its ketone functional group and a complex structure that includes a pyridine ring. This compound typically appears as a colorless to pale yellow liquid and is known for its distinctive odor. It is soluble in organic solvents, which makes it useful in various chemical applications, including as a potential intermediate in organic synthesis. The presence of the pyridine moiety contributes to its chemical reactivity and potential biological activity, making it of interest in medicinal chemistry. Additionally, the dimethyl groups enhance its steric properties, influencing its interactions in chemical reactions. Safety data sheets should be consulted for handling and storage guidelines, as with many organic compounds, it may pose health risks if not managed properly. Overall, 2,2-Dimethyl-1-(6-methyl-3-pyridinyl)-1-propanone is a compound of interest in both industrial and research settings due to its unique structural features.

Formula: C₁₁H₁₅NO

InChI: InChI=1S/C11H15NO/c1-8-5-6-9(7-12-8)10(13)11(2,3)4/h5-7H,1-4H3

InChI key: InChIKey=AIGXJTWZKJBTBB-UHFFFAOYSA-N

SMILES: C(C(C)(C)C)(=O)C=1C=CC(C)=NC1

Synonyms:

• 1-Propanone, 2,2-dimethyl-1-(6-methyl-3-pyridinyl)-
• 2,2-Dimethyl-1-(6-methyl-3-pyridinyl)-1-propanone