CAS 88203-19-4
:4-chloro-2-(chloromethyl)-5,6-dimethylthieno[2,3-d]pyrimidine
Description:
4-Chloro-2-(chloromethyl)-5,6-dimethylthieno[2,3-d]pyrimidine is a heterocyclic compound characterized by its thieno[2,3-d]pyrimidine core, which incorporates both sulfur and nitrogen atoms in its structure. This compound features a chloro group and a chloromethyl group, contributing to its reactivity and potential applications in medicinal chemistry. The presence of two methyl groups at the 5 and 6 positions enhances its lipophilicity, which may influence its biological activity and solubility properties. The thieno[2,3-d]pyrimidine framework is known for its role in various pharmacological activities, making this compound of interest in drug development. Its molecular structure suggests potential interactions with biological targets, and the halogen substituents may enhance its binding affinity or alter its metabolic stability. As with many heterocycles, the compound's properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and solvents used. Overall, 4-chloro-2-(chloromethyl)-5,6-dimethylthieno[2,3-d]pyrimidine represents a versatile scaffold for further chemical modifications and exploration in pharmaceutical research.
Formula:C9H8Cl2N2S
InChI:InChI=1/C9H8Cl2N2S/c1-4-5(2)14-9-7(4)8(11)12-6(3-10)13-9/h3H2,1-2H3
SMILES:Cc1c(C)sc2c1c(Cl)nc(CCl)n2
Synonyms:- 4-Chloro-2-chloromethyl-5,6-dimethyl-thieno[2,3-d]pyrimidine
- Thieno[2,3-D]Pyrimidine, 4-Chloro-2-(Chloromethyl)-5,6-Dimethyl-
- 4-Chloro-2-(chloromethyl)-5,6-dimethylthieno[2,3-d]pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Chloro-2-chloromethyl-5,6-dimethyl-thieno[2,3-d]pyrimidine
CAS:Formula:C9H8Cl2N2SMolecular weight:247.1442
