CymitQuimica logo

CAS 882041-44-3

:

1-methyl-3',6'-dihydrospiro[indole-3,2'-pyran]-2(1H)-one

Description:
1-Methyl-3',6'-dihydrospiro[indole-3,2'-pyran]-2(1H)-one, with the CAS number 882041-44-3, is a chemical compound characterized by its unique spirocyclic structure, which combines an indole and a pyran moiety. This compound typically exhibits a complex arrangement of carbon, nitrogen, and oxygen atoms, contributing to its potential biological activity. The presence of the indole ring suggests possible interactions with biological systems, as indole derivatives are known for their roles in various pharmacological activities. The spiro configuration can influence the compound's stereochemistry and reactivity, potentially affecting its solubility and stability. Additionally, the methyl group at the 1-position may enhance lipophilicity, impacting its bioavailability. Such compounds are of interest in medicinal chemistry for their potential applications in drug development, particularly in targeting neurological or cancer-related pathways. Overall, 1-methyl-3',6'-dihydrospiro[indole-3,2'-pyran]-2(1H)-one represents a fascinating area of study within organic and medicinal chemistry.
Formula:C13H13NO2
InChI:InChI=1/C13H13NO2/c1-14-11-7-3-2-6-10(11)13(12(14)15)8-4-5-9-16-13/h2-7H,8-9H2,1H3
Synonyms:
  • 882041-44-3
  • Spiro[3H-indole-3,2'-[2H]pyran]-2(1H)-one, 3',6'-dihydro-1-methyl-
  • 3',6'-DIHYDRO-1-METHYL-SPIRO[3H-INDOLE-3,2'-[2H]PYRAN]-2(1H)-ONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.