CymitQuimica logo

CAS 882041-45-4

:

1'-methyl-3H-spiro[furan-2,3'-indol]-2'(1'H)-one

Description:
1'-Methyl-3H-spiro[furan-2,3'-indol]-2'(1'H)-one is a chemical compound characterized by its unique spirocyclic structure, which consists of a fused furan and indole moiety. This compound typically exhibits a complex three-dimensional arrangement, contributing to its potential biological activity. The presence of the methyl group at the 1' position of the indole ring can influence its solubility and reactivity. As a spiro compound, it may display interesting properties such as chirality and specific interactions with biological targets, making it of interest in medicinal chemistry and drug design. The compound's CAS number, 882041-45-4, allows for its identification in chemical databases, facilitating research and development. Its synthesis and characterization may involve various organic reactions, and it could be evaluated for potential applications in pharmaceuticals, particularly in the development of novel therapeutic agents. Overall, the unique structural features of 1'-methyl-3H-spiro[furan-2,3'-indol]-2'(1'H)-one suggest that it may possess intriguing chemical and biological properties worthy of further investigation.
Formula:C12H11NO2
InChI:InChI=1/C12H11NO2/c1-13-10-6-3-2-5-9(10)12(11(13)14)7-4-8-15-12/h2-6,8H,7H2,1H3
Synonyms:
  • 1'-Methyl-spiro[furan-2(3H),3'-[3H]indol]-2'(1'H)-one
  • 882041-45-4
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.