CAS 882041-48-7
:4-iodo-1'-methyl-4,5-dihydro-3H-spiro[furan-2,3'-indol]-2'(1'H)-one
Description:
4-Iodo-1'-methyl-4,5-dihydro-3H-spiro[furan-2,3'-indol]-2'(1'H)-one is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both furan and indole moieties. This compound features an iodine atom at the 4-position, which can influence its reactivity and biological activity. The presence of the methyl group at the 1'-position contributes to its overall stability and steric properties. The dihydrofuran and indole components suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their known biological activities. The compound's structure may also exhibit interesting optical properties and could be explored for use in materials science. Its CAS number, 882041-48-7, allows for easy identification and retrieval of information in chemical databases. Overall, the unique structural features of this compound make it a subject of interest for further research in various fields, including organic synthesis and drug discovery.
Formula:C12H12INO2
InChI:InChI=1/C12H12INO2/c1-14-10-5-3-2-4-9(10)12(11(14)15)6-8(13)7-16-12/h2-5,8H,6-7H2,1H3
Synonyms:- 882041-48-7
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Iodo-1'-methyl-4,5-dihydro-3H-spiro[furan-2,3'-indolin]-2'-one
CAS:Formula:C12H12INO2Molecular weight:329.1336
