CAS 882041-50-1
:1',3-dimethyl-4-(prop-2-en-1-yl)-5H-spiro[furan-2,3'-indol]-2'(1'H)-one
Description:
1',3-Dimethyl-4-(prop-2-en-1-yl)-5H-spiro[furan-2,3'-indol]-2'(1'H)-one, with the CAS number 882041-50-1, is a complex organic compound characterized by its unique spirocyclic structure, which combines elements of both furan and indole. This compound features a spiro linkage that contributes to its three-dimensional conformation, influencing its chemical reactivity and potential biological activity. The presence of the dimethyl groups and the propenyl substituent suggests that it may exhibit interesting electronic properties and steric effects, which can affect its interactions in various chemical environments. Additionally, the compound may possess potential applications in medicinal chemistry, particularly due to the indole moiety, which is often associated with various pharmacological activities. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the functional groups present. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry, warranting further investigation into its properties and potential applications.
Formula:C16H17NO2
InChI:InChI=1/C16H17NO2/c1-4-7-12-10-19-16(11(12)2)13-8-5-6-9-14(13)17(3)15(16)18/h4-6,8-9H,1,7,10H2,2-3H3
Synonyms:- 882041-50-1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Allyl-1',3-dimethyl-5H-spiro[furan-2,3'-indolin]-2'-one
CAS:Formula:C16H17NO2Molecular weight:255.3117
