CymitQuimica logo

CAS 882041-51-2

:

3-methyl-5H-spiro[furan-2,3'-indol]-2'(1'H)-one

Description:
3-Methyl-5H-spiro[furan-2,3'-indol]-2'(1'H)-one is a chemical compound characterized by its unique spirocyclic structure, which combines a furan and an indole moiety. This compound features a fused ring system that contributes to its potential biological activity and chemical reactivity. The presence of the methyl group at the 3-position of the indole enhances its lipophilicity, which may influence its interaction with biological targets. The spiro configuration introduces strain and rigidity to the molecule, potentially affecting its conformational dynamics and stability. As a heterocyclic compound, it may exhibit interesting properties such as fluorescence or photochemical behavior, making it of interest in various fields, including medicinal chemistry and materials science. The compound's CAS number, 882041-51-2, allows for its identification in chemical databases, facilitating research and development efforts. Overall, 3-methyl-5H-spiro[furan-2,3'-indol]-2'(1'H)-one represents a fascinating subject for further investigation due to its structural complexity and potential applications.
Formula:C12H11NO2
InChI:InChI=1/C12H11NO2/c1-8-6-7-15-12(8)9-4-2-3-5-10(9)13-11(12)14/h2-6H,7H2,1H3,(H,13,14)
Synonyms:
  • 3-Methyl-spiro[furan-2(5H),3'-[3H]indol]-2'(1'H)-one
  • 882041-51-2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.