CymitQuimica logo

CAS 882041-52-3

:

3-methyl-4-(prop-2-en-1-yl)-5H-spiro[furan-2,3'-indol]-2'(1'H)-one

Description:
3-Methyl-4-(prop-2-en-1-yl)-5H-spiro[furan-2,3'-indol]-2'(1'H)-one is a complex organic compound characterized by its unique spirocyclic structure, which consists of a fused furan and indole moiety. This compound features a methyl group and a propenyl substituent, contributing to its reactivity and potential biological activity. The presence of the spiro linkage imparts distinctive stereochemical properties, which can influence its interactions in biological systems. The compound may exhibit various functional properties, including potential antioxidant or anti-inflammatory activities, making it of interest in medicinal chemistry. Its molecular structure suggests it could participate in various chemical reactions, such as electrophilic additions or substitutions, due to the presence of unsaturated bonds. The CAS number 882041-52-3 provides a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, the characteristics of this compound make it a subject of interest for further research in organic synthesis and pharmacology.
Formula:C15H15NO2
InChI:InChI=1/C15H15NO2/c1-3-6-11-9-18-15(10(11)2)12-7-4-5-8-13(12)16-14(15)17/h3-5,7-8H,1,6,9H2,2H3,(H,16,17)
Synonyms:
  • 882041-52-3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.