CymitQuimica logo

CAS 882041-53-4

:

4-bromo-1'-methyl-3-phenyl-5H-spiro[furan-2,3'-indol]-2'(1'H)-one

Description:
4-Bromo-1'-methyl-3-phenyl-5H-spiro[furan-2,3'-indol]-2'(1'H)-one is a complex organic compound characterized by its spirocyclic structure, which features a fused ring system comprising a furan and an indole moiety. The presence of a bromine atom at the 4-position and a methyl group at the 1'-position contributes to its unique chemical properties and reactivity. This compound is likely to exhibit interesting biological activities due to the indole structure, which is known for its presence in many natural products and pharmaceuticals. The spiro configuration can influence the compound's three-dimensional shape, potentially affecting its interactions with biological targets. Additionally, the phenyl group enhances the compound's hydrophobic character, which may influence its solubility and permeability in biological systems. Overall, 4-bromo-1'-methyl-3-phenyl-5H-spiro[furan-2,3'-indol]-2'(1'H)-one represents a class of compounds that may have applications in medicinal chemistry and materials science, although specific biological activities and applications would require further investigation.
Formula:C18H14BrNO2
InChI:InChI=1/C18H14BrNO2/c1-20-15-10-6-5-9-13(15)18(17(20)21)16(14(19)11-22-18)12-7-3-2-4-8-12/h2-10H,11H2,1H3
Synonyms:
  • 882041-53-4
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.