CAS 88206-93-3

7,10,13-Trioxa-4-azatricosanoic acid, 5,8,11-trimethyl-

Description:

7,10,13-Trioxa-4-azatricosanoic acid, 5,8,11-trimethyl- is a complex organic compound characterized by its unique structure that includes both azole and ether functionalities. The presence of three oxygen atoms in the form of ether linkages and one nitrogen atom in the azole group contributes to its potential solubility in polar solvents. This compound is likely to exhibit amphiphilic properties, making it useful in applications such as surfactants or emulsifiers. The trimethyl groups suggest a branched structure that may influence its physical properties, such as melting point and viscosity. Additionally, the length of the carbon chain indicates that it may have hydrophobic characteristics, which could affect its interaction with biological membranes. The compound's specific applications may include use in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, detailed studies on its reactivity, stability, and biological activity would be necessary to fully understand its potential uses and safety profile.

Formula: C₂₂H₄₅NO₅

InChI: InChI=1S/C22H45NO5/c1-5-6-7-8-9-10-11-12-15-26-17-20(3)28-18-21(4)27-16-19(2)23-14-13-22(24)25/h19-21,23H,5-18H2,1-4H3,(H,24,25)

InChI key: UAMNCHXOZUQLHU-UHFFFAOYSA-N

SMILES: CCCCCCCCCCOCC(C)OCC(C)OCC(C)NCCC(=O)O