CAS 88207-46-9
:2-(2-Bromophenyl)-1-(phenylsulfonyl)-1H-indole
Description:
2-(2-Bromophenyl)-1-(phenylsulfonyl)-1H-indole, with the CAS number 88207-46-9, is a chemical compound characterized by its complex structure, which includes an indole core substituted with a bromophenyl group and a phenylsulfonyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the indole structure, which is known for its role in various pharmacological applications. The bromine atom introduces a halogen, which can influence the compound's reactivity and solubility. The sulfonyl group enhances the compound's polarity, potentially affecting its interaction with biological targets. Additionally, the presence of multiple aromatic rings suggests that the compound may exhibit significant π-π stacking interactions, which can be relevant in drug design and molecular recognition processes. Overall, this compound's unique structural features may contribute to its utility in medicinal chemistry and materials science.
Formula:C20H14BrNO2S
InChI:InChI=1S/C20H14BrNO2S/c21-18-12-6-5-11-17(18)20-14-15-8-4-7-13-19(15)22(20)25(23,24)16-9-2-1-3-10-16/h1-14H
InChI key:InChIKey=QRAHXTPEZXOREH-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C(=CC=2C1=CC=CC2)C3=C(Br)C=CC=C3)C4=CC=CC=C4
Synonyms:- 2-(2-Bromophenyl)-1-(phenylsulfonyl)-1H-indole
- 1H-Indole, 2-(2-bromophenyl)-1-(phenylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
