CAS 88208-19-9

1-Butanol, 1,3-diethoxy-4-iodo-

Description:

1-Butanol, 1,3-diethoxy-4-iodo- is an organic compound characterized by its structure, which includes a butanol backbone with two ethoxy groups and an iodine substituent. This compound is likely to be a colorless to pale yellow liquid, exhibiting moderate volatility and solubility in organic solvents due to the presence of both hydrophobic (butanol and ethoxy) and hydrophilic (ethoxy) components. The iodine atom introduces unique reactivity, potentially allowing for nucleophilic substitution reactions. Its molecular structure suggests it may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. The presence of multiple functional groups can also influence its physical properties, such as boiling point and density, as well as its reactivity in various chemical environments. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, 1-Butanol, 1,3-diethoxy-4-iodo- is a versatile compound with potential utility in various chemical applications.

Formula: C₈H₁₇IO₃

InChI: InChI=1S/C8H17IO3/c1-3-11-7(6-9)5-8(10)12-4-2/h7-8,10H,3-6H2,1-2H3

InChI key: RGJMJRLFTLWISA-UHFFFAOYSA-N

SMILES: CCOC(CC(O)OCC)CI