CAS 88208-85-9

3-Phenanthrenecarboxaldehyde, 1,4,8-trimethoxy-2-methyl-

Description:

3-Phenanthrenecarboxaldehyde, 1,4,8-trimethoxy-2-methyl- is an organic compound characterized by its complex aromatic structure, which includes a phenanthrene backbone. This compound features a carboxaldehyde functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of three methoxy groups (–OCH3) at the 1, 4, and 8 positions of the phenanthrene ring contributes to its solubility and electronic properties, enhancing its potential as a ligand in coordination chemistry or as a precursor in the synthesis of more complex molecules. The methyl group at the 2-position further modifies its steric and electronic characteristics. This compound may exhibit interesting photophysical properties due to its conjugated system, making it a candidate for applications in materials science, such as organic light-emitting diodes (OLEDs) or as a dye. Additionally, its unique structure may provide avenues for biological activity, warranting further investigation in medicinal chemistry. Overall, 3-Phenanthrenecarboxaldehyde, 1,4,8-trimethoxy-2-methyl- is a versatile compound with potential applications across various fields of chemistry.

Formula: C₁₉H₁₈O₄

InChI: InChI=1S/C19H18O4/c1-11-15(10-20)19(23-4)17-13-6-5-7-16(21-2)12(13)8-9-14(17)18(11)22-3/h5-10H,1-4H3

InChI key: VKZVSLIDWALPEN-UHFFFAOYSA-N

SMILES: CC1=C(C(=C2C3=C(C=CC2=C1OC)C(=CC=C3)OC)OC)C=O