CAS 88208-86-0

1,4-Phenanthrenedione, 8-methoxy-3-(methoxymethyl)-2-methyl-

Description:

1,4-Phenanthrenedione, 8-methoxy-3-(methoxymethyl)-2-methyl- is an organic compound characterized by its complex polycyclic structure, which includes a phenanthrene backbone with various functional groups. This compound features two methoxy groups and a methoxymethyl group, contributing to its chemical reactivity and solubility properties. Typically, compounds of this nature exhibit properties such as moderate to high lipophilicity due to the presence of aromatic rings, which can influence their interactions in biological systems. The presence of carbonyl groups (ketones) in the phenanthrenedione structure can also impart unique reactivity, making it a potential candidate for various chemical reactions, including oxidation and reduction processes. Additionally, such compounds may exhibit interesting photophysical properties, which can be useful in applications like organic electronics or as dyes. Safety and handling considerations are essential, as with many organic compounds, due to potential toxicity or reactivity. Overall, the specific characteristics of this compound would depend on its purity, structural conformation, and the presence of substituents.

Formula: C₁₈H₁₆O₄

InChI: InChI=1S/C18H16O4/c1-10-14(9-21-2)18(20)16-12-5-4-6-15(22-3)11(12)7-8-13(16)17(10)19/h4-8H,9H2,1-3H3

InChI key: MKEVKUSYYCHNCC-UHFFFAOYSA-N

SMILES: CC1=C(C(=O)C2=C(C1=O)C=CC3=C2C=CC=C3OC)COC