CAS 88208-98-4

Benzeneheptanoic acid, 3,5-dimethoxy-, ethyl ester

Description:

Benzeneheptanoic acid, 3,5-dimethoxy-, ethyl ester, identified by CAS number 88208-98-4, is an organic compound characterized by its ester functional group and aromatic structure. This compound features a benzene ring substituted with two methoxy groups at the 3 and 5 positions, which contribute to its chemical properties and reactivity. The heptanoic acid moiety provides a longer carbon chain, enhancing its hydrophobic characteristics. As an ethyl ester, it is likely to exhibit moderate solubility in organic solvents while being less soluble in water. The presence of methoxy groups can influence the compound's polarity and potential interactions in biological systems. This compound may be of interest in various applications, including pharmaceuticals, agrochemicals, or as a flavoring agent, due to its aromatic nature and potential biological activity. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any risks associated with its use.

Formula: C₁₇H₂₆O₄

InChI: InChI=1S/C17H26O4/c1-4-21-17(18)10-8-6-5-7-9-14-11-15(19-2)13-16(12-14)20-3/h11-13H,4-10H2,1-3H3

InChI key: JAGBSYCGTMFPFK-UHFFFAOYSA-N

SMILES: CCOC(=O)CCCCCCC1=CC(=CC(=C1)OC)OC