CymitQuimica logo

CAS 88212-13-9

:

(4R,12R,20R,24S,26R,28R)-4,12,20,24,26,28-hexahydroxytritriacontane-2,10,18-trione

Description:
The chemical substance known as (4R,12R,20R,24S,26R,28R)-4,12,20,24,26,28-hexahydroxytritriacontane-2,10,18-trione, with the CAS number 88212-13-9, is a complex organic compound characterized by its long carbon chain and multiple hydroxyl (–OH) groups. This structure suggests that it is a polyol, which typically exhibits high solubility in water and can participate in hydrogen bonding due to the presence of hydroxyl groups. The specific stereochemistry indicated by the R and S configurations suggests that the compound has multiple chiral centers, which can influence its biological activity and interactions. The presence of trione functional groups (three ketone groups) indicates potential reactivity, particularly in oxidation-reduction reactions. Such compounds may be of interest in various fields, including biochemistry and materials science, due to their potential applications in drug development, as surfactants, or in the synthesis of more complex molecules. However, detailed studies would be necessary to fully understand its properties and potential uses.
Formula:C33H62O9
InChI:InChI=1/C33H62O9/c1-3-4-7-13-30(39)23-33(42)24-32(41)19-12-18-31(40)22-29(38)17-11-6-10-16-28(37)21-27(36)15-9-5-8-14-26(35)20-25(2)34/h26,28,30-33,35,37,39-42H,3-24H2,1-2H3/t26-,28-,30-,31-,32+,33-/m1/s1
Synonyms:
  • 2,10,18-Tritriacontanetrione, 4,12,20,24,26,28-hexahydroxy-, (4R,12R,20R,24S,26R,28R)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.