CAS 88214-10-2

2,2'-Bipyridinium, 1,5,5'-trimethyl-, iodide

Description:

2,2'-Bipyridinium, 1,5,5'-trimethyl-, iodide, commonly referred to as a quaternary ammonium compound, is characterized by its structure, which consists of two pyridine rings connected by a bipyridinium framework, with three methyl groups attached to one of the nitrogen atoms. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its ionic nature. It exhibits properties typical of quaternary ammonium salts, including antimicrobial activity and the ability to act as a phase transfer catalyst. The iodide counterion contributes to its solubility and stability in various chemical environments. Additionally, this compound can participate in redox reactions, making it useful in electrochemical applications. Its unique structural features and properties make it valuable in research and industrial applications, particularly in organic synthesis and as a reagent in various chemical processes. Safety precautions should be observed when handling this compound, as with many quaternary ammonium salts, due to potential toxicity and environmental impact.

Formula: C₁₃H₁₅N₂I

InChI: InChI=1S/C13H15N2.2HI/c1-10-4-6-12(14-8-10)13-7-5-11(2)9-15(13)3;;/h4-9H,1-3H3;2*1H/q+1;;/p-1

InChI key: QPQDUQAZNGOXCG-UHFFFAOYSA-M

SMILES: CC1=C[NH+]=C(C=C1)C2=[N+](C=C(C=C2)C)C.[I-].[I-]