CAS 88216-99-3
:2,6-dimethyl-1-(3-methylbut-2-enoyl)piperidine
Description:
2,6-Dimethyl-1-(3-methylbut-2-enoyl)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered nitrogen-containing heterocycle. The presence of two methyl groups at the 2 and 6 positions of the piperidine ring contributes to its hydrophobic character and influences its steric properties. The compound also features a 3-methylbut-2-enoyl substituent, which introduces a conjugated system that can participate in various chemical reactions, such as Michael additions or Diels-Alder reactions. This substituent enhances the compound's reactivity and may affect its biological activity, making it of interest in medicinal chemistry. The overall structure suggests potential applications in the synthesis of pharmaceuticals or agrochemicals. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of functional groups and the overall molecular geometry. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and environmental impact.
Formula:C12H21NO
InChI:InChI=1/C12H21NO/c1-9(2)8-12(14)13-10(3)6-5-7-11(13)4/h8,10-11H,5-7H2,1-4H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
