CAS 88217-77-0

1,2-Benzisothiazole-3(2H)-thione, 2-[2-(4-methylphenyl)ethyl]-

Description:

1,2-Benzisothiazole-3(2H)-thione, 2-[2-(4-methylphenyl)ethyl]- is a chemical compound characterized by its unique structure, which includes a benzisothiazole moiety and an ethyl group substituted with a para-methylphenyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the thiazole ring, which can participate in various chemical reactions. It may display moderate to high lipophilicity, influencing its solubility in organic solvents and its potential interactions in biological systems. The presence of the methylphenyl group can enhance its stability and alter its reactivity. Additionally, compounds of this class are often investigated for their applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. Safety data and handling precautions should be considered, as with any chemical substance, due to potential toxicity or environmental impact. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₁₆H₁₅NS₂

InChI: InChI=1S/C16H15NS2/c1-12-6-8-13(9-7-12)10-11-17-16(18)14-4-2-3-5-15(14)19-17/h2-9H,10-11H2,1H3

InChI key: NAHANBFULOUQOK-UHFFFAOYSA-N

SMILES: CC1=CC=C(C=C1)CCN2C(=S)C3=CC=CC=C3S2