CAS 88217-97-4
:3,5-dinitrobenzyl (1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate
Description:
3,5-Dinitrobenzyl (1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate is a chemical compound characterized by its complex structure, which includes a dinitrobenzyl moiety and a cyclopropanecarboxylate group. The presence of the dinitro group indicates that the compound may exhibit significant electron-withdrawing properties, potentially influencing its reactivity and solubility. The cyclopropane ring contributes to the compound's rigidity and may affect its stereochemistry, as indicated by the (1R,3S) configuration. The dichloroethenyl substituent adds to the compound's potential for reactivity, particularly in electrophilic reactions. This compound may be of interest in various fields, including organic synthesis and medicinal chemistry, due to its unique structural features. Its CAS number, 88217-97-4, allows for easy identification in chemical databases. As with many organic compounds, safety and handling precautions should be observed, given the potential hazards associated with its components, particularly the dinitro and dichloro groups.
Formula:C15H14Cl2N2O6
InChI:InChI=1/C15H14Cl2N2O6/c1-15(2)11(6-12(16)17)13(15)14(20)25-7-8-3-9(18(21)22)5-10(4-8)19(23)24/h3-6,11,13H,7H2,1-2H3/t11-,13+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,5-dinitrobenzyl(1r,3s)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate
CAS:Formula:C15H13Cl2N2O6Molecular weight:388.1795
