CAS 88221-13-0
:4-(5-Chloro-2-benzofuranyl)-2-pyrrolidinone
Description:
4-(5-Chloro-2-benzofuranyl)-2-pyrrolidinone, identified by its CAS number 88221-13-0, is a chemical compound that features a pyrrolidinone ring fused with a benzofuran moiety. This compound is characterized by its unique structural arrangement, which includes a chloro substituent on the benzofuran, contributing to its potential biological activity. The presence of the pyrrolidinone ring suggests that it may exhibit properties typical of lactams, such as being a potential precursor in organic synthesis or a candidate for pharmaceutical applications. The chloro group can influence the compound's reactivity and solubility, affecting its interactions in biological systems. Additionally, compounds of this type may be investigated for their pharmacological properties, including neuroactive or anti-inflammatory effects. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the purity and specific conditions under which the compound is studied. Overall, 4-(5-Chloro-2-benzofuranyl)-2-pyrrolidinone represents a class of compounds with potential utility in medicinal chemistry.
Formula:C12H10ClNO2
InChI:InChI=1S/C12H10ClNO2/c13-9-1-2-10-7(3-9)4-11(16-10)8-5-12(15)14-6-8/h1-4,8H,5-6H2,(H,14,15)
InChI key:InChIKey=KYCWLDNOCUYUPY-UHFFFAOYSA-N
SMILES:O=C1CC(C2=CC=3C(O2)=CC=C(Cl)C3)CN1
Synonyms:- 4-(5-Chloro-2-benzofuranyl)-2-pyrrolidinone
- 2-Pyrrolidinone, 4-(5-chloro-2-benzofuranyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
