CAS 882248-22-8

(5-chloro-4,6-dimethyl-1-benzofuran-3-yl)acetic acid

Description:

(5-Chloro-4,6-dimethyl-1-benzofuran-3-yl)acetic acid is an organic compound characterized by its benzofuran structure, which features a fused benzene and furan ring system. The presence of chlorine and methyl groups at specific positions on the benzofuran ring contributes to its unique chemical properties and reactivity. This compound contains a carboxylic acid functional group, which imparts acidic characteristics and allows for potential interactions in various chemical reactions, such as esterification or amidation. The chlorine substituent may influence the compound's polarity and solubility in different solvents, while the methyl groups can affect steric hindrance and electronic distribution. Overall, this compound's structural features suggest potential applications in pharmaceuticals or agrochemicals, where modifications to the benzofuran core can lead to diverse biological activities. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used or synthesized.

Formula: C₁₂H₁₁ClO₃

InChI: InChI=1/C12H11ClO3/c1-6-3-9-11(7(2)12(6)13)8(5-16-9)4-10(14)15/h3,5H,4H2,1-2H3,(H,14,15)

SMILES: Cc1cc2c(c(C)c1Cl)c(CC(=O)O)co2

Synonyms:

• 3-Benzofuranacetic Acid, 5-Chloro-4,6-Dimethyl-
• (5-Chloro-4,6-dimethyl-1-benzofuran-3-yl)acetic acid