CAS 88226-45-3

3-Nonanone, 4-[(acetyloxy)methyl]-4-nitro-

Description:

3-Nonanone, 4-[(acetyloxy)methyl]-4-nitro- is an organic compound characterized by its ketone functional group and the presence of both an acetyloxy and a nitro substituent. This compound features a nonane backbone, which consists of a nine-carbon chain, with a ketone group located at the third carbon. The acetyloxy group is attached to the fourth carbon, while the nitro group is also positioned at the fourth carbon, contributing to its reactivity and potential applications in various chemical processes. The presence of these functional groups suggests that the compound may exhibit polar characteristics, influencing its solubility in different solvents. Additionally, the nitro group can impart unique electronic properties, making it a candidate for further chemical transformations or applications in synthetic organic chemistry. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks or environmental hazards.

Formula: C₁₂H₂₁NO₅

InChI: InChI=1S/C12H21NO5/c1-4-6-7-8-12(13(16)17,11(15)5-2)9-18-10(3)14/h4-9H2,1-3H3

InChI key: GPWPAJLHNZXCKQ-UHFFFAOYSA-N

SMILES: CCCCCC(COC(=O)C)(C(=O)CC)[N+](=O)[O-]