CymitQuimica logo

CAS 88227-11-6

:

1-benzyl-3,3,5,5-tetradeuterio-piperidin-4-ol

Description:
1-Benzyl-3,3,5,5-tetradeuterio-piperidin-4-ol is a deuterated derivative of piperidin-4-ol, which is a cyclic amine with a hydroxyl group. The presence of deuterium, a stable isotope of hydrogen, in the 3 and 5 positions of the piperidine ring enhances its utility in various analytical techniques, particularly in NMR spectroscopy, where it can provide clearer spectral data due to the differences in magnetic properties compared to hydrogen. This compound features a benzyl group attached to the nitrogen atom of the piperidine ring, which can influence its solubility and reactivity. The hydroxyl group contributes to its potential as a hydrogen bond donor, affecting its interactions in biological systems or chemical reactions. Additionally, the presence of deuterium can alter the physical properties, such as boiling and melting points, compared to its non-deuterated counterparts. Overall, this compound is of interest in medicinal chemistry and research applications where isotopic labeling is beneficial for tracking molecular behavior.
Formula:C12H13D4NO
InChI:InChI=1/C12H17NO/c14-12-6-8-13(9-7-12)10-11-4-2-1-3-5-11/h1-5,12,14H,6-10H2/i6D2,7D2
SMILES:c1ccc(cc1)CN1CC(C(C(C1)([2H])[2H])O)([2H])[2H]
Synonyms:
  • 1-Benzyl-piperidine-3,3,5,5-d4-4-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.