CAS 88229-15-6
:N-Cyclopropyl-3-fluorobenzamide
Description:
N-Cyclopropyl-3-fluorobenzamide is a chemical compound characterized by its unique structure, which includes a cyclopropyl group and a fluorobenzamide moiety. This compound features a cyclopropyl ring, a three-membered carbon ring known for its strain and reactivity, which can influence the compound's overall chemical behavior. The presence of a fluorine atom at the meta position of the benzene ring enhances the compound's lipophilicity and can affect its biological activity. As an amide, it contains a carbonyl group (C=O) directly bonded to a nitrogen atom, which contributes to its stability and potential interactions in biological systems. N-Cyclopropyl-3-fluorobenzamide may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its CAS number, 88229-15-6, allows for easy identification in chemical databases. Overall, this compound's structural features suggest potential applications in drug development and materials science, warranting further investigation into its properties and uses.
Formula:C10H10FNO
InChI:InChI=1S/C10H10FNO/c11-8-3-1-2-7(6-8)10(13)12-9-4-5-9/h1-3,6,9H,4-5H2,(H,12,13)
InChI key:InChIKey=XJJUHXYBQZBFEW-UHFFFAOYSA-N
SMILES:C(NC1CC1)(=O)C2=CC(F)=CC=C2
Synonyms:- Benzamide, N-cyclopropyl-3-fluoro-
- N-Cyclopropyl-3-fluorobenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
