CymitQuimica logo

CAS 88229-19-0

:

N-Cyclopropyl-2-iodobenzamide

Description:
N-Cyclopropyl-2-iodobenzamide is a chemical compound characterized by its unique structure, which includes a cyclopropyl group and an iodobenzamide moiety. This compound features a cyclopropyl ring, a three-membered carbon ring known for its strain and reactivity, attached to a benzamide group where an iodine atom is substituted at the ortho position relative to the amide functional group. The presence of the iodine atom enhances the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The amide functional group contributes to the compound's solubility in polar solvents and its ability to participate in hydrogen bonding. N-Cyclopropyl-2-iodobenzamide may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, boiling point, and spectral characteristics, would typically be determined through experimental methods and may vary based on purity and environmental conditions.
Formula:C10H10INO
InChI:InChI=1S/C10H10INO/c11-9-4-2-1-3-8(9)10(13)12-7-5-6-7/h1-4,7H,5-6H2,(H,12,13)
InChI key:InChIKey=WWSGALIECDFDFC-UHFFFAOYSA-N
SMILES:C(NC1CC1)(=O)C2=C(I)C=CC=C2
Synonyms:
  • N-Cyclopropyl-2-iodobenzamide
  • Benzamide, N-cyclopropyl-2-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.