CymitQuimica logo

CAS 88229-20-3

:

N-Cyclopropyl-2-nitrobenzamide

Description:
N-Cyclopropyl-2-nitrobenzamide is an organic compound characterized by its unique structure, which includes a cyclopropyl group and a nitro group attached to a benzamide framework. This compound typically exhibits a solid state at room temperature and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the nitro group contributes to its reactivity, making it a candidate for various chemical transformations. Additionally, the cyclopropyl moiety can influence the compound's biological activity and pharmacokinetic properties. N-Cyclopropyl-2-nitrobenzamide may also display specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Its molecular interactions can be studied through various analytical techniques, including NMR and mass spectrometry, which help elucidate its structure and confirm its identity. Overall, this compound represents a valuable entity in the field of organic synthesis and drug discovery, warranting further investigation into its properties and potential uses.
Formula:C10H10N2O3
InChI:InChI=1S/C10H10N2O3/c13-10(11-7-5-6-7)8-3-1-2-4-9(8)12(14)15/h1-4,7H,5-6H2,(H,11,13)
InChI key:InChIKey=LWENPBZQINYOPC-UHFFFAOYSA-N
SMILES:C(NC1CC1)(=O)C2=C(N(=O)=O)C=CC=C2
Synonyms:
  • N-Cyclopropyl-2-nitrobenzamide
  • Benzamide, N-cyclopropyl-2-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.