CAS 88229-30-5
:N-(Diphenylmethyl)-2-fluorobenzamide
Description:
N-(Diphenylmethyl)-2-fluorobenzamide, identified by its CAS number 88229-30-5, is an organic compound characterized by its unique structure, which includes a fluorobenzamide moiety and a diphenylmethyl group. This compound typically exhibits a solid state at room temperature and is known for its moderate solubility in organic solvents, such as dichloromethane and ethanol, while being less soluble in water. The presence of the fluorine atom in the benzamide structure can influence its chemical reactivity and biological activity, often enhancing lipophilicity and altering pharmacokinetic properties. N-(Diphenylmethyl)-2-fluorobenzamide may be of interest in medicinal chemistry and drug development due to its potential applications in targeting specific biological pathways. Its synthesis generally involves the reaction of appropriate amines and aromatic compounds, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. As with many organic compounds, safety precautions should be observed when handling this substance, given the potential for toxicity and environmental impact.
Formula:C20H16FNO
InChI:InChI=1S/C20H16FNO/c21-18-14-8-7-13-17(18)20(23)22-19(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,19H,(H,22,23)
InChI key:InChIKey=WTPQAJFYUKESTF-UHFFFAOYSA-N
SMILES:C(NC(=O)C1=C(F)C=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- N-(Diphenylmethyl)-2-fluorobenzamide
- Benzamide, N-(diphenylmethyl)-2-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
