CAS 88230-54-0
:2-[2-Bromo-5-(4-bromo-2-cyanophenoxy)phenoxy]propanoyl chloride
Description:
2-[2-Bromo-5-(4-bromo-2-cyanophenoxy)phenoxy]propanoyl chloride, with the CAS number 88230-54-0, is a synthetic organic compound characterized by its complex structure, which includes multiple functional groups. This compound features a propanoyl chloride moiety, indicating the presence of an acyl chloride functional group, which is known for its reactivity, particularly in acylation reactions. The presence of bromine and cyanophenoxy groups suggests potential applications in medicinal chemistry and material science, as halogenated compounds often exhibit unique electronic properties and biological activities. The compound is likely to be a solid at room temperature, with solubility in organic solvents such as dichloromethane or acetone, but limited solubility in water due to its hydrophobic characteristics. Safety precautions should be taken when handling this compound, as acyl chlorides can be corrosive and may release harmful gases upon reaction with moisture. Overall, its structural complexity and functional groups make it a candidate for further research in various chemical applications.
Formula:C16H10Br2ClNO3
InChI:InChI=1S/C16H10Br2ClNO3/c1-9(16(19)21)22-15-7-12(3-4-13(15)18)23-14-5-2-11(17)6-10(14)8-20/h2-7,9H,1H3
InChI key:InChIKey=FLFZMKJHDIMPLK-UHFFFAOYSA-N
SMILES:O(C1=C(C#N)C=C(Br)C=C1)C2=CC(OC(C(Cl)=O)C)=C(Br)C=C2
Synonyms:- 2-[2-Bromo-5-(4-bromo-2-cyanophenoxy)phenoxy]propanoyl chloride
- Propanoyl chloride, 2-[2-bromo-5-(4-bromo-2-cyanophenoxy)phenoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Propanoyl chloride, 2-[2-bromo-5-(4-bromo-2-cyanophenoxy)phenoxy]-
CAS:Formula:C16H10Br2ClNO3Molecular weight:459.5165
