CymitQuimica logo

CAS 88234-78-0

:

2-(2,2-Dimethoxyethoxy)-3-methoxybenzaldehyde

Description:
2-(2,2-Dimethoxyethoxy)-3-methoxybenzaldehyde is an organic compound characterized by its complex structure, which includes a benzaldehyde functional group and multiple methoxy groups. The presence of the methoxy groups enhances its solubility in organic solvents and may influence its reactivity and interaction with other chemical species. This compound typically exhibits a moderate to high boiling point due to the presence of multiple ether linkages, which can also affect its volatility. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The compound may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, owing to its functional groups that can participate in various chemical reactions. Additionally, its structure suggests potential for hydrogen bonding, which could influence its physical properties such as melting point and solubility. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C12H16O5
InChI:InChI=1S/C12H16O5/c1-14-10-6-4-5-9(7-13)12(10)17-8-11(15-2)16-3/h4-7,11H,8H2,1-3H3
InChI key:InChIKey=QUBFAWQLVHIXLT-UHFFFAOYSA-N
SMILES:O(CC(OC)OC)C1=C(C=O)C=CC=C1OC
Synonyms:
  • Benzaldehyde, 2-(2,2-dimethoxyethoxy)-3-methoxy-
  • 2-(2,2-Dimethoxyethoxy)-3-methoxybenzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.