CAS 88237-23-4
:4-Aminobenzaldehyde hydrazone
Description:
4-Aminobenzaldehyde hydrazone, with the CAS number 88237-23-4, is an organic compound characterized by the presence of both an aldehyde and a hydrazone functional group. It typically appears as a crystalline solid and is known for its potential applications in various fields, including pharmaceuticals and organic synthesis. The compound features a hydrazone linkage formed by the reaction of 4-aminobenzaldehyde with hydrazine, resulting in a structure that can exhibit tautomerism. This compound may display properties such as solubility in polar solvents and varying degrees of stability depending on environmental conditions. Additionally, it can participate in various chemical reactions, including condensation and oxidation, making it a versatile intermediate in synthetic chemistry. Its biological activity may also be of interest, as similar compounds have been studied for their potential antimicrobial and anticancer properties. As with any chemical substance, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C7H9N3
InChI:InChI=1S/C7H9N3/c8-7-3-1-6(2-4-7)5-10-9/h1-5H,8-9H2
InChI key:InChIKey=SEFDCFLYBJVLQZ-UHFFFAOYSA-N
SMILES:C(=NN)C1=CC=C(N)C=C1
Synonyms:- Benzaldehyde, 4-amino-, hydrazone
- 4-Aminobenzaldehyde hydrazone
- Benzaldehyde, p-amino-, hydrazone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
