CAS 88237-32-5

2-Oxetanone, 4,4-bis(chlorodifluoromethyl)-3-(trimethylgermyl)-

Description:

2-Oxetanone, 4,4-bis(chlorodifluoromethyl)-3-(trimethylgermyl)-, identified by CAS number 88237-32-5, is a specialized organic compound characterized by its unique structural features. It contains a four-membered cyclic ketone (oxetanone) with substituents that include chlorodifluoromethyl groups and a trimethylgermyl group. The presence of the chlorodifluoromethyl groups imparts significant polarity and potential reactivity, making the compound of interest in various chemical applications, particularly in materials science and organic synthesis. The trimethylgermyl group introduces a silicon-like character, which can influence the compound's electronic properties and stability. This compound is likely to exhibit distinct physical properties, such as a specific boiling point and solubility profile, influenced by its functional groups. Additionally, due to the presence of halogen atoms, it may demonstrate unique reactivity patterns, particularly in nucleophilic substitution reactions. Overall, 2-Oxetanone, 4,4-bis(chlorodifluoromethyl)-3-(trimethylgermyl)- is a complex molecule with potential applications in advanced chemical research and development.

Formula: C₈H₁₀Cl₂F₄GeO₂

InChI: InChI=1S/C8H10Cl2F4GeO2/c1-15(2,3)4-5(16)17-6(4,7(9,11)12)8(10,13)14/h4H,1-3H3

InChI key: KKQQRVKYTJUGHD-UHFFFAOYSA-N

SMILES: C[Ge](C)(C)C1C(=O)OC1(C(F)(F)Cl)C(F)(F)Cl