CAS 88241-67-2

2-Propenoic acid, 3-[1,1′-biphenyl]-4-yl-, (Z)-

Description:

2-Propenoic acid, 3-[1,1′-biphenyl]-4-yl-, (Z)-, also known by its CAS number 88241-67-2, is an organic compound characterized by its structure, which features a propenoic acid moiety with a biphenyl substituent. This compound typically exhibits properties associated with unsaturated carboxylic acids, including the ability to participate in various chemical reactions such as polymerization and esterification. The (Z)- configuration indicates that the substituents on the double bond are on the same side, which can influence its reactivity and physical properties. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the biphenyl group may impart unique electronic and steric properties, making it of interest in materials science and organic synthesis. Additionally, compounds of this nature may exhibit biological activity, although specific biological properties would require further investigation. Safety data should be consulted for handling and usage, as with all chemical substances.

Formula: C₁₅H₁₂O₂

InChI: InChI=1S/C15H12O2/c16-15(17)11-8-12-6-9-14(10-7-12)13-4-2-1-3-5-13/h1-11H,(H,16,17)/b11-8-

InChI key: InChIKey=DMJDEZUEYXVYNO-FLIBITNWSA-N

SMILES: C(=C\C(O)=O)\C1=CC=C(C=C1)C2=CC=CC=C2

Synonyms:

• 2-Propenoic acid, 3-[1,1′-biphenyl]-4-yl-, (Z)-

2-Propenoic acid, 3-[1,1'-biphenyl]-4-yl-, (Z)-

CAS: 88241-67-2

Formula: C₁₅H₁₂O₂

Molecular weight: 224.2546

Ref: IN-DA004AN2