CAS 882430-69-5
:6-acetamido-3-bromo-pyridine-2-carboxylic acid
Description:
6-Acetamido-3-bromo-pyridine-2-carboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at specific positions. The presence of an acetamido group at the 6-position and a bromo group at the 3-position contributes to its unique reactivity and properties. This compound features a carboxylic acid functional group at the 2-position, which enhances its acidity and potential for forming salts or esters. The bromine atom introduces electrophilic characteristics, making it suitable for further chemical modifications. The compound is typically used in pharmaceutical research and development due to its potential biological activity. Its solubility in polar solvents is influenced by the carboxylic acid and acetamido groups, while the bromine substitution can affect its overall stability and reactivity. As with many pyridine derivatives, it may exhibit interesting interactions with biological targets, making it a subject of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly those with halogen substituents.
Formula:C8H7BrN2O3
InChI:InChI=1/C8H7BrN2O3/c1-4(12)10-6-3-2-5(9)7(11-6)8(13)14/h2-3H,1H3,(H,13,14)(H,10,11,12)
SMILES:CC(=Nc1ccc(c(C(=O)O)n1)Br)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Acetamido-3-bromopicolinic acid
CAS:Formula:C8H7BrN2O3Color and Shape:SolidMolecular weight:259.05686-Acetamido-3-bromopyridine-2-carboxylic acid
CAS:<p>6-Acetamido-3-bromopyridine-2-carboxylic acid</p>Purity:96%Molecular weight:259.06g/mol6-Acetamido-3-bromopicolinic Acid
CAS:Controlled Product<p>Applications 6-Acetamido-3-bromopicolinic Acid is a chemical reagent used in the preparation of anti-retroviral agents. Derivative of Picolinic Acid (P437220), used in the preparation of 2-Aminodihydro[1,3]thiazines as BACE 2 inhibitors and their preparation and use in the treatment of diabetes.<br>References Denny, W., et al.: J. Med. Chem., 33, 814 (1990), Maurya, M., et al.: J. Chem. Res., 446 (1998),<br></p>Formula:C8H7BrN2O3Color and Shape:NeatMolecular weight:259.066-Acetamido-3-bromopicolinic Acid
CAS:<p>Versatile small molecule scaffold</p>Formula:C8H7BrN2O3Purity:Min. 95%Molecular weight:259.06 g/mol



