CAS 882489-65-8

1-cyclopropylcyclopropanamine

Description:

1-Cyclopropylcyclopropanamine is a chemical compound characterized by its unique bicyclic structure, which includes two cyclopropane rings and an amine functional group. This compound is notable for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of the cyclopropyl groups can influence the compound's steric and electronic properties, potentially affecting its reactivity and biological activity. As an amine, it may participate in hydrogen bonding and can act as a nucleophile in various chemical reactions. The compound's relatively small size and unique ring structure may also contribute to its lipophilicity, impacting its pharmacokinetic properties. Additionally, the specific arrangement of atoms in 1-cyclopropylcyclopropanamine can lead to interesting conformational dynamics, which may be relevant in the context of drug design and optimization. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₆H₁₁N

InChI: InChI=1/C6H11N/c7-6(3-4-6)5-1-2-5/h5H,1-4,7H2

SMILES: C1CC1C1(CC1)N

Synonyms:

• 1,1'-BI(CYCLOPROPYL)-1-AMINE
• 1,1'-bi(cyclopropyl)-1-amine(SALTDATA: HCl)
• 1,1'-Bi(cyclopropyl)-1-amine hydrochloride
• 1-CYCLOPROPYLCYCLOPROPAN-1-AMINE
• 1-cyclopropylcyclopropanamine
• 1,1'-Bi(cyclopropan)]-1-amine

[1,1'-Bi(cyclopropan)]-1-amine

CAS: 882489-65-8

Formula: C₆H₁₁N

Molecular weight: 97.1582

Ref: IN-DA004AMQ