CAS 882500-21-2

5-bromo-6-(trifluoromethyl)pyridin-2-amine

Description:

5-Bromo-6-(trifluoromethyl)pyridin-2-amine is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 5-position and a trifluoromethyl group (-CF3) at the 6-position significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and is soluble in organic solvents, making it useful in various chemical reactions and applications. The trifluoromethyl group enhances the lipophilicity and metabolic stability of the molecule, which can be advantageous in pharmaceutical development. Additionally, the amino group (-NH2) at the 2-position can participate in hydrogen bonding and nucleophilic reactions, further expanding its utility in synthetic chemistry. Overall, 5-bromo-6-(trifluoromethyl)pyridin-2-amine is of interest in medicinal chemistry and material science due to its unique structural features and potential biological activity.

Formula: C₆H₄BrF₃N₂

InChI: InChI=1/C6H4BrF3N2/c7-3-1-2-4(11)12-5(3)6(8,9)10/h1-2H,(H2,11,12)

SMILES: c1cc(=N)[nH]c(c1Br)C(F)(F)F

Synonyms:

• 5-Bromo-6-trifluoromethyl-pyridin-2-ylamine
• 6-Amino-3-bromo-2-(trifluoromethyl)pyridine

6-Amino-3-Bromo-2-trifluoromethylpyridine

CAS: 882500-21-2

Formula: C₆H₄BrF₃N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 241.0086

Ref: IN-DA003N2G

5-Bromo-6-trifluoromethylpyridin-2-ylamine

CAS: 882500-21-2

5-Bromo-6-trifluoromethylpyridin-2-ylamine

Purity: 99%

Molecular weight: 241.01g/mol

Ref: 54-PC201346

5-Bromo-6-trifluoromethylpyridin-2-ylamine

CAS: 882500-21-2

Formula: C₆H₄BrF₃N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 241.011

Ref: 10-F077397